C14H28N4O2 — CID 167071063
tert-butyl (3S,5R)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-methylpiperidine-1-carboxylate (PubChem CID 167071063) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167071063 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl (3S,5R)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-methylpiperidine-1-carboxylate |
| SMILES | C/N=C(\NC)N[C@H]1C[C@@H](C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N4O2/c1-10-7-11(17-12(15-5)16-6)9-18(8-10)13(19)20-14(2,3)4/h10-11H,7-9H2,1-6H3,(H2,15,16,17)/t10-,11+/m1/s1 |
| InChIKey | MPNJITJORCMZSB-MNOVXSKESA-N |
| XLogP | 1.43 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|