C9H19NO4 — CID 167071088
(2R,3S,5R)-4-ethenyl-6-(methylamino)hexane-1,2,3,5-tetrol (PubChem CID 167071088) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is (2R,3S,5R)-4-ethenyl-6-(methylamino)hexane-1,2,3,5-tetrol.
| Compound Name | (2R,3S,5R)-4-ethenyl-6-(methylamino)hexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 167071088 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2R,3S,5R)-4-ethenyl-6-(methylamino)hexane-1,2,3,5-tetrol |
| SMILES | C=CC([C@@H](O)CNC)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H19NO4/c1-3-6(7(12)4-10-2)9(14)8(13)5-11/h3,6-14H,1,4-5H2,2H3/t6?,7-,8+,9-/m0/s1 |
| InChIKey | RVVYARLDQTXTMN-HNACHXKJSA-N |
| XLogP | -1.92 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|