C27H29F3N4O4S — CID 167071172
7-methyl-8-(3-methylpiperazin-1-yl)-3-[4-(methylsulfanylamino)-3-(trifluoromethoxy)benzoyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 167071172) has the molecular formula C27H29F3N4O4S and a molecular weight of 562.61 g/mol. Its IUPAC name is 7-methyl-8-(3-methylpiperazin-1-yl)-3-[4-(methylsulfanylamino)-3-(trifluoromethoxy)benzoyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
| Compound Name | 7-methyl-8-(3-methylpiperazin-1-yl)-3-[4-(methylsulfanylamino)-3-(trifluoromethoxy)benzoyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 167071172 |
| Molecular Formula | C27H29F3N4O4S |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | 7-methyl-8-(3-methylpiperazin-1-yl)-3-[4-(methylsulfanylamino)-3-(trifluoromethoxy)benzoyl]-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | CSNc1ccc(C(=O)N2CCc3c(c(=O)oc4c(C)c(N5CCNC(C)C5)ccc34)C2)cc1OC(F)(F)F |
| InChI | InChI=1S/C27H29F3N4O4S/c1-15-13-33(11-9-31-15)22-7-5-19-18-8-10-34(14-20(18)26(36)37-24(19)16(22)2)25(35)17-4-6-21(32-39-3)23(12-17)38-27(28,29)30/h4-7,12,15,31-32H,8-11,13-14H2,1-3H3 |
| InChIKey | OIYACBUJWQPRSK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|