C13H23NO — CID 167071214
(2Z)-2-methyl-3-(4-methylpent-3-enyl)-5,6,7,8-tetrahydro-4H-1,4-oxazocine (PubChem CID 167071214) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2Z)-2-methyl-3-(4-methylpent-3-enyl)-5,6,7,8-tetrahydro-4H-1,4-oxazocine.
| Compound Name | (2Z)-2-methyl-3-(4-methylpent-3-enyl)-5,6,7,8-tetrahydro-4H-1,4-oxazocine |
|---|---|
| PubChem CID | 167071214 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2Z)-2-methyl-3-(4-methylpent-3-enyl)-5,6,7,8-tetrahydro-4H-1,4-oxazocine |
| SMILES | CC(C)=CCC/C1=C(\C)OCCCCN1 |
| InChI | InChI=1S/C13H23NO/c1-11(2)7-6-8-13-12(3)15-10-5-4-9-14-13/h7,14H,4-6,8-10H2,1-3H3/b13-12- |
| InChIKey | GVBYLDCOACPNEU-SEYXRHQNSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|