C24H31NO9 — CID 167071451
3-[2-[2-[2-[[2-(2,6-dioxohexan-3-yl)-1,3-dioxoinden-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 167071451) has the molecular formula C24H31NO9 and a molecular weight of 477.51 g/mol. Its IUPAC name is 3-[2-[2-[2-[[2-(2,6-dioxohexan-3-yl)-1,3-dioxoinden-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[[2-(2,6-dioxohexan-3-yl)-1,3-dioxoinden-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 167071451 |
| Molecular Formula | C24H31NO9 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-[2-[2-[2-[[2-(2,6-dioxohexan-3-yl)-1,3-dioxoinden-4-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CC(=O)C(CCC=O)C1C(=O)c2cccc(NCCOCCOCCOCCC(=O)O)c2C1=O |
| InChI | InChI=1S/C24H31NO9/c1-16(27)17(5-3-9-26)22-23(30)18-4-2-6-19(21(18)24(22)31)25-8-11-33-13-15-34-14-12-32-10-7-20(28)29/h2,4,6,9,17,22,25H,3,5,7-8,10-15H2,1H3,(H,28,29) |
| InChIKey | JVKHPLTZDIGUEV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|