C18H30F3N5O2 — CID 167071940
1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 167071940) has the molecular formula C18H30F3N5O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167071940 |
| Molecular Formula | C18H30F3N5O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[2-[amino-[(Z)-2-amino-2-cyclopropylethenyl]amino]-3,3-dimethylbutanoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C(C(=O)N1CCCC1C(=O)NCC(F)(F)F)N(N)/C=C(\N)C1CC1 |
| InChI | InChI=1S/C18H30F3N5O2/c1-17(2,3)14(26(23)9-12(22)11-6-7-11)16(28)25-8-4-5-13(25)15(27)24-10-18(19,20)21/h9,11,13-14H,4-8,10,22-23H2,1-3H3,(H,24,27)/b12-9- |
| InChIKey | WWDHCHMOFNTSJE-XFXZXTDPSA-N |
| XLogP | 1.46 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|