C19H40N2O8 — CID 167072159
2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-2-[2-[2-(2-aminoethoxy)ethoxy]ethoxymethyl]-2-methylpropoxy]acetaldehyde (PubChem CID 167072159) has the molecular formula C19H40N2O8 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-2-[2-[2-(2-aminoethoxy)ethoxy]ethoxymethyl]-2-methylpropoxy]acetaldehyde.
| Compound Name | 2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-2-[2-[2-(2-aminoethoxy)ethoxy]ethoxymethyl]-2-methylpropoxy]acetaldehyde |
|---|---|
| PubChem CID | 167072159 |
| Molecular Formula | C19H40N2O8 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-2-[2-[2-(2-aminoethoxy)ethoxy]ethoxymethyl]-2-methylpropoxy]acetaldehyde |
| SMILES | CC(COCC=O)(COCCOCCOCCN)COCCOCCOCCN |
| InChI | InChI=1S/C19H40N2O8/c1-19(16-27-7-4-22,17-28-14-12-25-10-8-23-5-2-20)18-29-15-13-26-11-9-24-6-3-21/h4H,2-3,5-18,20-21H2,1H3 |
| InChIKey | BCMSKJRQGCURAR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|