About 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine
1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine (PubChem CID 167072490) has the molecular formula C28H25N
and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine.
Molecular Properties
| Compound Name | 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine |
| PubChem CID | 167072490 |
| Molecular Formula | C28H25N |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine |
| SMILES | C=C(/N=C(\C)C1=C[C@@H](c2ccccc2)CC(c2ccccc2)=C1)c1ccccc1 |
| InChI | InChI=1S/C28H25N/c1-21(23-12-6-3-7-13-23)29-22(2)26-18-27(24-14-8-4-9-15-24)20-28(19-26)25-16-10-5-11-17-25/h3-19,27H,1,20H2,2H3/b29-22+/t27-/m1/s1 |
| InChIKey | HJPXYNKATBXKNX-KBWVQGRMSA-N |
| XLogP | 7.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine?
The IUPAC name of 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine (CID 167072490) is 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine.
What is the SMILES notation for 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine?
The canonical SMILES for 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine is C=C(/N=C(\C)C1=C[C@@H](c2ccccc2)CC(c2ccccc2)=C1)c1ccccc1.
What is the InChIKey of 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine?
The InChIKey is HJPXYNKATBXKNX-KBWVQGRMSA-N. The full InChI is InChI=1S/C28H25N/c1-21(23-12-6-3-7-13-23)29-22(2)26-18-27(24-14-8-4-9-15-24)20-28(19-26)25-16-10-5-11-17-25/h3-19,27H,1,20H2,2H3/b29-22+/t27-/m1/s1.
What are the key properties of 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine?
1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine has a molecular weight of 375.52 g/mol, XLogP of 7.32, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3,5-diphenylcyclohexa-1,5-dien-1-yl]-N-(1-phenylethenyl)ethanimine is sourced from PubChem (CID 167072490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).