C19H27NS — CID 167072972
(4E,6Z)-2-ethylsulfanyl-N-[(1Z)-3-methylpenta-1,4-dienyl]-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-3-imine (PubChem CID 167072972) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is (4E,6Z)-2-ethylsulfanyl-N-[(1Z)-3-methylpenta-1,4-dienyl]-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-3-imine.
| Compound Name | (4E,6Z)-2-ethylsulfanyl-N-[(1Z)-3-methylpenta-1,4-dienyl]-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-3-imine |
|---|---|
| PubChem CID | 167072972 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (4E,6Z)-2-ethylsulfanyl-N-[(1Z)-3-methylpenta-1,4-dienyl]-4-[(Z)-prop-1-enyl]octa-1,4,6-trien-3-imine |
| SMILES | C=CC(C)/C=C\N=C(C(=C)SCC)\C(/C=C\C)=C\C=C/C |
| InChI | InChI=1S/C19H27NS/c1-7-11-13-18(12-8-2)19(17(6)21-10-4)20-15-14-16(5)9-3/h7-9,11-16H,3,6,10H2,1-2,4-5H3/b11-7-,12-8-,15-14-,18-13+,20-19+ |
| InChIKey | YDMRAPPBTJIVEY-UAQUYEQUSA-N |
| XLogP | 6.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|