About [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate
[(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate (PubChem CID 167073505) has the molecular formula C12H11ClFN3S
and a molecular weight of 283.76 g/mol. Its IUPAC name is [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate.
Molecular Properties
| Compound Name | [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate |
| PubChem CID | 167073505 |
| Molecular Formula | C12H11ClFN3S |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate |
| SMILES | [H]/N=C(Cl)/C=C\C(=C)S/C(=N\C)c1ccc(F)nc1 |
| InChI | InChI=1S/C12H11ClFN3S/c1-8(3-5-10(13)15)18-12(16-2)9-4-6-11(14)17-7-9/h3-7,15H,1H2,2H3/b5-3-,15-10-,16-12- |
| InChIKey | IHGKRCQPKAKBNM-PRJXGYQTSA-N |
| XLogP | 3.62 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate?
The IUPAC name of [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate (CID 167073505) is [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate.
What is the SMILES notation for [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate?
The canonical SMILES for [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate is [H]/N=C(Cl)/C=C\C(=C)S/C(=N\C)c1ccc(F)nc1.
What is the InChIKey of [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate?
The InChIKey is IHGKRCQPKAKBNM-PRJXGYQTSA-N. The full InChI is InChI=1S/C12H11ClFN3S/c1-8(3-5-10(13)15)18-12(16-2)9-4-6-11(14)17-7-9/h3-7,15H,1H2,2H3/b5-3-,15-10-,16-12-.
What are the key properties of [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate?
[(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate has a molecular weight of 283.76 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-5-chloro-5-iminopenta-1,3-dien-2-yl] 6-fluoro-N-methylpyridine-3-carboximidothioate is sourced from PubChem (CID 167073505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).