About (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole
(4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole (PubChem CID 167073555) has the molecular formula C13H18BrNS
and a molecular weight of 300.27 g/mol. Its IUPAC name is (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole.
Molecular Properties
| Compound Name | (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole |
| PubChem CID | 167073555 |
| Molecular Formula | C13H18BrNS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole |
| SMILES | C/C=C(\CC)c1nc(=C/CC)/c(=C\CBr)s1 |
| InChI | InChI=1S/C13H18BrNS/c1-4-7-11-12(8-9-14)16-13(15-11)10(5-2)6-3/h5,7-8H,4,6,9H2,1-3H3/b10-5+,11-7+,12-8+ |
| InChIKey | ICOWZINPWYGHJB-PDQBKZBTSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole?
The IUPAC name of (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole (CID 167073555) is (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole.
What is the SMILES notation for (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole?
The canonical SMILES for (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole is C/C=C(\CC)c1nc(=C/CC)/c(=C\CBr)s1.
What is the InChIKey of (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole?
The InChIKey is ICOWZINPWYGHJB-PDQBKZBTSA-N. The full InChI is InChI=1S/C13H18BrNS/c1-4-7-11-12(8-9-14)16-13(15-11)10(5-2)6-3/h5,7-8H,4,6,9H2,1-3H3/b10-5+,11-7+,12-8+.
What are the key properties of (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole?
(4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole has a molecular weight of 300.27 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-5-(2-bromoethylidene)-2-[(E)-pent-2-en-3-yl]-4-propylidene-1,3-thiazole is sourced from PubChem (CID 167073555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).