C15H16ClNS — CID 167073682
6-chloro-2-[(4E,6Z)-octa-4,6-dien-4-yl]thieno[2,3-b]pyridine (PubChem CID 167073682) has the molecular formula C15H16ClNS and a molecular weight of 277.82 g/mol. Its IUPAC name is 6-chloro-2-[(4E,6Z)-octa-4,6-dien-4-yl]thieno[2,3-b]pyridine.
| Compound Name | 6-chloro-2-[(4E,6Z)-octa-4,6-dien-4-yl]thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 167073682 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-chloro-2-[(4E,6Z)-octa-4,6-dien-4-yl]thieno[2,3-b]pyridine |
| SMILES | C/C=C\C=C(/CCC)c1cc2ccc(Cl)nc2s1 |
| InChI | InChI=1S/C15H16ClNS/c1-3-5-7-11(6-4-2)13-10-12-8-9-14(16)17-15(12)18-13/h3,5,7-10H,4,6H2,1-2H3/b5-3-,11-7+ |
| InChIKey | UVFGSXHLCQZHLB-HOTIPDSSSA-N |
| XLogP | 5.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|