C19H23FO — CID 167073814
6-cyclohexa-2,4-dien-1-yl-8-fluoro-3,3-dimethyl-2,3a,4a,7,8,8a-hexahydrocyclopenta[b][1]benzofuran (PubChem CID 167073814) has the molecular formula C19H23FO and a molecular weight of 286.39 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-yl-8-fluoro-3,3-dimethyl-2,3a,4a,7,8,8a-hexahydrocyclopenta[b][1]benzofuran.
| Compound Name | 6-cyclohexa-2,4-dien-1-yl-8-fluoro-3,3-dimethyl-2,3a,4a,7,8,8a-hexahydrocyclopenta[b][1]benzofuran |
|---|---|
| PubChem CID | 167073814 |
| Molecular Formula | C19H23FO |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-yl-8-fluoro-3,3-dimethyl-2,3a,4a,7,8,8a-hexahydrocyclopenta[b][1]benzofuran |
| SMILES | CC1(C)CC=C2C3C(F)CC(C4C=CC=CC4)=CC3OC21 |
| InChI | InChI=1S/C19H23FO/c1-19(2)9-8-14-17-15(20)10-13(11-16(17)21-18(14)19)12-6-4-3-5-7-12/h3-6,8,11-12,15-18H,7,9-10H2,1-2H3 |
| InChIKey | NQXDNYNLYAQMTK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|