C20H26O — CID 167073853
3-butyl-6-(2,5-dimethylcyclopenta-1,3,4-trien-1-yl)-2-methyl-2,3,4,5-tetrahydro-1-benzofuran (PubChem CID 167073853) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-butyl-6-(2,5-dimethylcyclopenta-1,3,4-trien-1-yl)-2-methyl-2,3,4,5-tetrahydro-1-benzofuran.
| Compound Name | 3-butyl-6-(2,5-dimethylcyclopenta-1,3,4-trien-1-yl)-2-methyl-2,3,4,5-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 167073853 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 3-butyl-6-(2,5-dimethylcyclopenta-1,3,4-trien-1-yl)-2-methyl-2,3,4,5-tetrahydro-1-benzofuran |
| SMILES | CCCCC1C2=C(C=C(C3=C(C)C=C=C3C)CC2)OC1C |
| InChI | InChI=1S/C20H26O/c1-5-6-7-17-15(4)21-19-12-16(10-11-18(17)19)20-13(2)8-9-14(20)3/h8,12,15,17H,5-7,10-11H2,1-4H3 |
| InChIKey | QGDJKMYVQCTMSQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |