C16H27NO — CID 167074211
3-octan-2-yl-2,4,5,6-tetrahydro-1,3-benzoxazine (PubChem CID 167074211) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-octan-2-yl-2,4,5,6-tetrahydro-1,3-benzoxazine.
| Compound Name | 3-octan-2-yl-2,4,5,6-tetrahydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 167074211 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3-octan-2-yl-2,4,5,6-tetrahydro-1,3-benzoxazine |
| SMILES | CCCCCCC(C)N1COC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C16H27NO/c1-3-4-5-6-9-14(2)17-12-15-10-7-8-11-16(15)18-13-17/h8,11,14H,3-7,9-10,12-13H2,1-2H3 |
| InChIKey | IVQQDQRYUDEYSK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|