C13H21FS — CID 167074445
(2E,4E,6Z)-5-fluoro-7-(2-methylsulfanylethyl)deca-2,4,6-triene (PubChem CID 167074445) has the molecular formula C13H21FS and a molecular weight of 228.38 g/mol. Its IUPAC name is (2E,4E,6Z)-5-fluoro-7-(2-methylsulfanylethyl)deca-2,4,6-triene.
| Compound Name | (2E,4E,6Z)-5-fluoro-7-(2-methylsulfanylethyl)deca-2,4,6-triene |
|---|---|
| PubChem CID | 167074445 |
| Molecular Formula | C13H21FS |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (2E,4E,6Z)-5-fluoro-7-(2-methylsulfanylethyl)deca-2,4,6-triene |
| SMILES | C/C=C/C=C(F)\C=C(\CCC)CCSC |
| InChI | InChI=1S/C13H21FS/c1-4-6-8-13(14)11-12(7-5-2)9-10-15-3/h4,6,8,11H,5,7,9-10H2,1-3H3/b6-4+,12-11-,13-8+ |
| InChIKey | YFKSDFRSURCEPG-KBFGWKEPSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|