C30H41N3O — CID 167074702
2-[(E)-2-[(cyclobutylamino)methyl]-3-cyclopropylprop-1-enyl]imino-N-[(3E,5Z)-7-(6-methylcyclohepta-1,3,5-trien-1-yl)hepta-3,5-dien-3-yl]but-3-enamide (PubChem CID 167074702) has the molecular formula C30H41N3O and a molecular weight of 459.68 g/mol. Its IUPAC name is 2-[(E)-2-[(cyclobutylamino)methyl]-3-cyclopropylprop-1-enyl]imino-N-[(3E,5Z)-7-(6-methylcyclohepta-1,3,5-trien-1-yl)hepta-3,5-dien-3-yl]but-3-enamide.
| Compound Name | 2-[(E)-2-[(cyclobutylamino)methyl]-3-cyclopropylprop-1-enyl]imino-N-[(3E,5Z)-7-(6-methylcyclohepta-1,3,5-trien-1-yl)hepta-3,5-dien-3-yl]but-3-enamide |
|---|---|
| PubChem CID | 167074702 |
| Molecular Formula | C30H41N3O |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 2-[(E)-2-[(cyclobutylamino)methyl]-3-cyclopropylprop-1-enyl]imino-N-[(3E,5Z)-7-(6-methylcyclohepta-1,3,5-trien-1-yl)hepta-3,5-dien-3-yl]but-3-enamide |
| SMILES | C=C/C(=N\C=C(\CNC1CCC1)CC1CC1)C(=O)N/C(=C/C=C\CC1=CC=CC=C(C)C1)CC |
| InChI | InChI=1S/C30H41N3O/c1-4-27(14-9-8-13-24-12-7-6-11-23(3)19-24)33-30(34)29(5-2)32-22-26(20-25-17-18-25)21-31-28-15-10-16-28/h5-9,11-12,14,22,25,28,31H,2,4,10,13,15-21H2,1,3H3,(H,33,34)/b9-8-,26-22+,27-14+,32-29+ |
| InChIKey | ZZKHLKKLKWPLAY-RIEOZMCMSA-N |
| XLogP | 6.63 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|