C16H22N2O — CID 167075098
N-[(3Z,5E)-5-[(E)-1-(prop-2-enylideneamino)prop-1-en-2-yl]hepta-1,3,5-trien-2-yl]propanamide (PubChem CID 167075098) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[(3Z,5E)-5-[(E)-1-(prop-2-enylideneamino)prop-1-en-2-yl]hepta-1,3,5-trien-2-yl]propanamide.
| Compound Name | N-[(3Z,5E)-5-[(E)-1-(prop-2-enylideneamino)prop-1-en-2-yl]hepta-1,3,5-trien-2-yl]propanamide |
|---|---|
| PubChem CID | 167075098 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[(3Z,5E)-5-[(E)-1-(prop-2-enylideneamino)prop-1-en-2-yl]hepta-1,3,5-trien-2-yl]propanamide |
| SMILES | C=C/C=N/C=C(C)/C(/C=C\C(=C)NC(=O)CC)=C/C |
| InChI | InChI=1S/C16H22N2O/c1-6-11-17-12-13(4)15(7-2)10-9-14(5)18-16(19)8-3/h6-7,9-12H,1,5,8H2,2-4H3,(H,18,19)/b10-9-,13-12+,15-7+,17-11+ |
| InChIKey | SBYGOPPVKLGMJN-VBNSPMFXSA-N |
| XLogP | 3.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|