C12H19NO — CID 167075157
1-methyl-4-propan-2-yl-2,3,7,7a-tetrahydroindol-6-ol (PubChem CID 167075157) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-methyl-4-propan-2-yl-2,3,7,7a-tetrahydroindol-6-ol.
| Compound Name | 1-methyl-4-propan-2-yl-2,3,7,7a-tetrahydroindol-6-ol |
|---|---|
| PubChem CID | 167075157 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-methyl-4-propan-2-yl-2,3,7,7a-tetrahydroindol-6-ol |
| SMILES | CC(C)C1=C2CCN(C)C2CC(O)=C1 |
| InChI | InChI=1S/C12H19NO/c1-8(2)11-6-9(14)7-12-10(11)4-5-13(12)3/h6,8,12,14H,4-5,7H2,1-3H3 |
| InChIKey | VJJVVCHUKSZGRO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |