C30H23ClF3N5O3 — CID 167075560
N-[(2S)-1-[(2'S,3R)-5-chloro-2'-cyano-2-hydroxyspiro[1,2-dihydroindole-3,4'-pyrrolidine]-1'-yl]-3-(2-fluorophenyl)-1-oxopropan-2-yl]-4,6-difluoro-1H-indole-2-carboxamide (PubChem CID 167075560) has the molecular formula C30H23ClF3N5O3 and a molecular weight of 593.99 g/mol. Its IUPAC name is N-[(2S)-1-[(2'S,3R)-5-chloro-2'-cyano-2-hydroxyspiro[1,2-dihydroindole-3,4'-pyrrolidine]-1'-yl]-3-(2-fluorophenyl)-1-oxopropan-2-yl]-4,6-difluoro-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[(2'S,3R)-5-chloro-2'-cyano-2-hydroxyspiro[1,2-dihydroindole-3,4'-pyrrolidine]-1'-yl]-3-(2-fluorophenyl)-1-oxopropan-2-yl]-4,6-difluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167075560 |
| Molecular Formula | C30H23ClF3N5O3 |
| Molecular Weight | 593.99 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | N-[(2S)-1-[(2'S,3R)-5-chloro-2'-cyano-2-hydroxyspiro[1,2-dihydroindole-3,4'-pyrrolidine]-1'-yl]-3-(2-fluorophenyl)-1-oxopropan-2-yl]-4,6-difluoro-1H-indole-2-carboxamide |
| SMILES | N#C[C@@H]1C[C@]2(CN1C(=O)[C@H](Cc1ccccc1F)NC(=O)c1cc3c(F)cc(F)cc3[nH]1)c1cc(Cl)ccc1NC2O |
| InChI | InChI=1S/C30H23ClF3N5O3/c31-16-5-6-23-20(8-16)30(29(42)38-23)12-18(13-35)39(14-30)28(41)26(7-15-3-1-2-4-21(15)33)37-27(40)25-11-19-22(34)9-17(32)10-24(19)36-25/h1-6,8-11,18,26,29,36,38,42H,7,12,14H2,(H,37,40)/t18-,26-,29?,30-/m0/s1 |
| InChIKey | GTWJMAPTDJJLCX-XSYZYGQXSA-N |
| XLogP | 4.39 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.99 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |