C28H28F3N5O4 — CID 167075900
(2'S,3R)-1'-[(2S)-4-hydroxy-2-[[hydroxy-(4,6,7-trifluoro-1H-indol-2-yl)methyl]-methylamino]-4-methylpentanoyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonitrile (PubChem CID 167075900) has the molecular formula C28H28F3N5O4 and a molecular weight of 555.56 g/mol. Its IUPAC name is (2'S,3R)-1'-[(2S)-4-hydroxy-2-[[hydroxy-(4,6,7-trifluoro-1H-indol-2-yl)methyl]-methylamino]-4-methylpentanoyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonitrile.
| Compound Name | (2'S,3R)-1'-[(2S)-4-hydroxy-2-[[hydroxy-(4,6,7-trifluoro-1H-indol-2-yl)methyl]-methylamino]-4-methylpentanoyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonitrile |
|---|---|
| PubChem CID | 167075900 |
| Molecular Formula | C28H28F3N5O4 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (2'S,3R)-1'-[(2S)-4-hydroxy-2-[[hydroxy-(4,6,7-trifluoro-1H-indol-2-yl)methyl]-methylamino]-4-methylpentanoyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonitrile |
| SMILES | CN(C(O)c1cc2c(F)cc(F)c(F)c2[nH]1)[C@@H](CC(C)(C)O)C(=O)N1C[C@]2(C[C@H]1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H28F3N5O4/c1-27(2,40)11-21(35(3)24(37)20-8-15-17(29)9-18(30)22(31)23(15)33-20)25(38)36-13-28(10-14(36)12-32)16-6-4-5-7-19(16)34-26(28)39/h4-9,14,21,24,33,37,40H,10-11,13H2,1-3H3,(H,34,39)/t14-,21-,24?,28-/m0/s1 |
| InChIKey | FAKZSBGEMBOMCH-VDFCXJQPSA-N |
| XLogP | 3.05 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|