C19H28O4 — CID 167076108
benzyl (2S)-2,5-dimethyl-5-(2-methylpropanoyloxy)hexanoate (PubChem CID 167076108) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is benzyl (2S)-2,5-dimethyl-5-(2-methylpropanoyloxy)hexanoate.
| Compound Name | benzyl (2S)-2,5-dimethyl-5-(2-methylpropanoyloxy)hexanoate |
|---|---|
| PubChem CID | 167076108 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | benzyl (2S)-2,5-dimethyl-5-(2-methylpropanoyloxy)hexanoate |
| SMILES | CC(C)C(=O)OC(C)(C)CC[C@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28O4/c1-14(2)17(20)23-19(4,5)12-11-15(3)18(21)22-13-16-9-7-6-8-10-16/h6-10,14-15H,11-13H2,1-5H3/t15-/m0/s1 |
| InChIKey | IBZJBIMXHLOOBE-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |