About N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine
N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine (PubChem CID 167076432) has the molecular formula C21H42N2
and a molecular weight of 322.58 g/mol. Its IUPAC name is N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine |
| PubChem CID | 167076432 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine |
| SMILES | CC(C)(C)CC1CCC(NCCC(C)(C)CC2CC(N)C2)CC1 |
| InChI | InChI=1S/C21H42N2/c1-20(2,3)14-16-6-8-19(9-7-16)23-11-10-21(4,5)15-17-12-18(22)13-17/h16-19,23H,6-15,22H2,1-5H3 |
| InChIKey | DUYJJAARTXTSLU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine?
The IUPAC name of N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine (CID 167076432) is N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine.
What is the SMILES notation for N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine?
The canonical SMILES for N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine is CC(C)(C)CC1CCC(NCCC(C)(C)CC2CC(N)C2)CC1.
What is the InChIKey of N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine?
The InChIKey is DUYJJAARTXTSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N2/c1-20(2,3)14-16-6-8-19(9-7-16)23-11-10-21(4,5)15-17-12-18(22)13-17/h16-19,23H,6-15,22H2,1-5H3.
What are the key properties of N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine?
N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine has a molecular weight of 322.58 g/mol, XLogP of 5.11, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-aminocyclobutyl)-3,3-dimethylbutyl]-4-(2,2-dimethylpropyl)cyclohexan-1-amine is sourced from PubChem (CID 167076432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).