C17H21F3N4O2 — CID 167076904
3-amino-1-ethyl-4-[2-[2-oxo-3-(2,2,2-trifluoroethylamino)-1-pyridinyl]propyl]pyridin-2-one (PubChem CID 167076904) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 3-amino-1-ethyl-4-[2-[2-oxo-3-(2,2,2-trifluoroethylamino)-1-pyridinyl]propyl]pyridin-2-one.
| Compound Name | 3-amino-1-ethyl-4-[2-[2-oxo-3-(2,2,2-trifluoroethylamino)-1-pyridinyl]propyl]pyridin-2-one |
|---|---|
| PubChem CID | 167076904 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-amino-1-ethyl-4-[2-[2-oxo-3-(2,2,2-trifluoroethylamino)-1-pyridinyl]propyl]pyridin-2-one |
| SMILES | CCn1ccc(CC(C)n2cccc(NCC(F)(F)F)c2=O)c(N)c1=O |
| InChI | InChI=1S/C17H21F3N4O2/c1-3-23-8-6-12(14(21)16(23)26)9-11(2)24-7-4-5-13(15(24)25)22-10-17(18,19)20/h4-8,11,22H,3,9-10,21H2,1-2H3 |
| InChIKey | ZYGFEADKTSBLFO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|