C15H15ClN6O3S — CID 167077237
1-[(2R)-1-amino-1-hydroxypropan-2-yl]-N-(4-chloro-3-cyano-1H-indol-7-yl)pyrazole-4-sulfonamide (PubChem CID 167077237) has the molecular formula C15H15ClN6O3S and a molecular weight of 394.84 g/mol. Its IUPAC name is 1-[(2R)-1-amino-1-hydroxypropan-2-yl]-N-(4-chloro-3-cyano-1H-indol-7-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-[(2R)-1-amino-1-hydroxypropan-2-yl]-N-(4-chloro-3-cyano-1H-indol-7-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 167077237 |
| Molecular Formula | C15H15ClN6O3S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[(2R)-1-amino-1-hydroxypropan-2-yl]-N-(4-chloro-3-cyano-1H-indol-7-yl)pyrazole-4-sulfonamide |
| SMILES | C[C@H](C(N)O)n1cc(S(=O)(=O)Nc2ccc(Cl)c3c(C#N)c[nH]c23)cn1 |
| InChI | InChI=1S/C15H15ClN6O3S/c1-8(15(18)23)22-7-10(6-20-22)26(24,25)21-12-3-2-11(16)13-9(4-17)5-19-14(12)13/h2-3,5-8,15,19,21,23H,18H2,1H3/t8-,15?/m1/s1 |
| InChIKey | UDYKDFJZWPLNQW-ARAKYBCZSA-N |
| XLogP | 1.53 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|