C24H31BrFN3O3 — CID 167077876
N-(3-bromo-4-fluorophenyl)-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-oxocyclohexane-1-carboxamide (PubChem CID 167077876) has the molecular formula C24H31BrFN3O3 and a molecular weight of 508.43 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-oxocyclohexane-1-carboxamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-oxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167077876 |
| Molecular Formula | C24H31BrFN3O3 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-oxocyclohexane-1-carboxamide |
| SMILES | CC(C)(C)c1noc(CCCCCN(C(=O)C2CCC(=O)CC2)c2ccc(F)c(Br)c2)n1 |
| InChI | InChI=1S/C24H31BrFN3O3/c1-24(2,3)23-27-21(32-28-23)7-5-4-6-14-29(17-10-13-20(26)19(25)15-17)22(31)16-8-11-18(30)12-9-16/h10,13,15-16H,4-9,11-12,14H2,1-3H3 |
| InChIKey | VQNJBEPFKZTCFG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|