C17H14O2 — CID 167077992
6-methyl-1,7-bis(prop-2-ynoxy)naphthalene (PubChem CID 167077992) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-methyl-1,7-bis(prop-2-ynoxy)naphthalene.
| Compound Name | 6-methyl-1,7-bis(prop-2-ynoxy)naphthalene |
|---|---|
| PubChem CID | 167077992 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 6-methyl-1,7-bis(prop-2-ynoxy)naphthalene |
| SMILES | C#CCOc1cc2c(OCC#C)cccc2cc1C |
| InChI | InChI=1S/C17H14O2/c1-4-9-18-16-8-6-7-14-11-13(3)17(12-15(14)16)19-10-5-2/h1-2,6-8,11-12H,9-10H2,3H3 |
| InChIKey | FRYJCLGWHDLQEN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|