C22H38N2S — CID 167078351
2-[2-[4-[[4-(2,2-dimethylpropyl)piperidin-1-yl]methyl]phenyl]ethylamino]propane-2-thiol (PubChem CID 167078351) has the molecular formula C22H38N2S and a molecular weight of 362.63 g/mol. Its IUPAC name is 2-[2-[4-[[4-(2,2-dimethylpropyl)piperidin-1-yl]methyl]phenyl]ethylamino]propane-2-thiol.
| Compound Name | 2-[2-[4-[[4-(2,2-dimethylpropyl)piperidin-1-yl]methyl]phenyl]ethylamino]propane-2-thiol |
|---|---|
| PubChem CID | 167078351 |
| Molecular Formula | C22H38N2S |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 2-[2-[4-[[4-(2,2-dimethylpropyl)piperidin-1-yl]methyl]phenyl]ethylamino]propane-2-thiol |
| SMILES | CC(C)(C)CC1CCN(Cc2ccc(CCNC(C)(C)S)cc2)CC1 |
| InChI | InChI=1S/C22H38N2S/c1-21(2,3)16-19-11-14-24(15-12-19)17-20-8-6-18(7-9-20)10-13-23-22(4,5)25/h6-9,19,23,25H,10-17H2,1-5H3 |
| InChIKey | FVAKJYFKIURZHS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|