About tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate
tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate (PubChem CID 167078714) has the molecular formula C19H38N2O7
and a molecular weight of 406.52 g/mol. Its IUPAC name is tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate.
Molecular Properties
| Compound Name | tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate |
| PubChem CID | 167078714 |
| Molecular Formula | C19H38N2O7 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate |
| SMILES | CC(C)NC(CCCCNC1OC(CO)C(O)C(O)C1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38N2O7/c1-11(2)21-12(18(26)28-19(3,4)5)8-6-7-9-20-17-16(25)15(24)14(23)13(10-22)27-17/h11-17,20-25H,6-10H2,1-5H3 |
| InChIKey | QXMMVZZFKDCRAL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 140.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate?
The IUPAC name of tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate (CID 167078714) is tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate.
What is the SMILES notation for tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate?
The canonical SMILES for tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate is CC(C)NC(CCCCNC1OC(CO)C(O)C(O)C1O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate?
The InChIKey is QXMMVZZFKDCRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2O7/c1-11(2)21-12(18(26)28-19(3,4)5)8-6-7-9-20-17-16(25)15(24)14(23)13(10-22)27-17/h11-17,20-25H,6-10H2,1-5H3.
What are the key properties of tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate?
tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate has a molecular weight of 406.52 g/mol, XLogP of -0.75, 10 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(propan-2-ylamino)-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]hexanoate is sourced from PubChem (CID 167078714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).