C17H18F6O2 — CID 167078970
1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxycyclohexa-1,3-dien-1-yl)propan-2-yl]-4-methoxycyclohexa-1,3-diene (PubChem CID 167078970) has the molecular formula C17H18F6O2 and a molecular weight of 368.32 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxycyclohexa-1,3-dien-1-yl)propan-2-yl]-4-methoxycyclohexa-1,3-diene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxycyclohexa-1,3-dien-1-yl)propan-2-yl]-4-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 167078970 |
| Molecular Formula | C17H18F6O2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-(4-methoxycyclohexa-1,3-dien-1-yl)propan-2-yl]-4-methoxycyclohexa-1,3-diene |
| SMILES | COC1=CC=C(C(C2=CC=C(OC)CC2)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H18F6O2/c1-24-13-7-3-11(4-8-13)15(16(18,19)20,17(21,22)23)12-5-9-14(25-2)10-6-12/h3,5,7,9H,4,6,8,10H2,1-2H3 |
| InChIKey | MGIUUOHIOAOTRE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |