C29H36ClF3N4OS — CID 167079579
(2S,6R)-2-[4-(4-chloro-13,13-dimethyl-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-6-ethyl-1,1,1-trifluoro-3-methyl-9-sulfanylnonan-5-one (PubChem CID 167079579) has the molecular formula C29H36ClF3N4OS and a molecular weight of 581.15 g/mol. Its IUPAC name is (2S,6R)-2-[4-(4-chloro-13,13-dimethyl-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-6-ethyl-1,1,1-trifluoro-3-methyl-9-sulfanylnonan-5-one.
| Compound Name | (2S,6R)-2-[4-(4-chloro-13,13-dimethyl-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-6-ethyl-1,1,1-trifluoro-3-methyl-9-sulfanylnonan-5-one |
|---|---|
| PubChem CID | 167079579 |
| Molecular Formula | C29H36ClF3N4OS |
| Molecular Weight | 581.15 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (2S,6R)-2-[4-(4-chloro-13,13-dimethyl-2,3,7,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-yl)phenyl]-6-ethyl-1,1,1-trifluoro-3-methyl-9-sulfanylnonan-5-one |
| SMILES | CC[C@H](CCCS)C(=O)CC(C)[C@@H](c1ccc(N2CCC(C)(C)c3c2cnc2cc(Cl)nn32)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H36ClF3N4OS/c1-5-19(7-6-14-39)23(38)15-18(2)26(29(31,32)33)20-8-10-21(11-9-20)36-13-12-28(3,4)27-22(36)17-34-25-16-24(30)35-37(25)27/h8-11,16-19,26,39H,5-7,12-15H2,1-4H3/t18?,19-,26+/m1/s1 |
| InChIKey | BCTCALWLBIZNRF-QJVREYQTSA-N |
| XLogP | 8.18 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.15 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|