C12H15NO — CID 167079716
5-cyclopropyl-2-cyclopropyloxy-3-methylpyridine (PubChem CID 167079716) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-cyclopropyl-2-cyclopropyloxy-3-methylpyridine.
| Compound Name | 5-cyclopropyl-2-cyclopropyloxy-3-methylpyridine |
|---|---|
| PubChem CID | 167079716 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-cyclopropyl-2-cyclopropyloxy-3-methylpyridine |
| SMILES | Cc1cc(C2CC2)cnc1OC1CC1 |
| InChI | InChI=1S/C12H15NO/c1-8-6-10(9-2-3-9)7-13-12(8)14-11-4-5-11/h6-7,9,11H,2-5H2,1H3 |
| InChIKey | NFSCOODOOHSQGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |