C27H23F5N4O5S — CID 167079756
5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-[4-[(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)methoxy]phenyl]pyrimidine-2,4-diamine (PubChem CID 167079756) has the molecular formula C27H23F5N4O5S and a molecular weight of 610.56 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-[4-[(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)methoxy]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-[4-[(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)methoxy]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167079756 |
| Molecular Formula | C27H23F5N4O5S |
| Molecular Weight | 610.56 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | 5-fluoro-2-N-[4-(2-methoxyethoxy)phenyl]-4-N-[4-[(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)methoxy]phenyl]pyrimidine-2,4-diamine |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3ccc(OCc4c(F)c(F)c(F)c(F)c4S(C)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C27H23F5N4O5S/c1-39-11-12-40-17-7-5-16(6-8-17)35-27-33-13-20(28)26(36-27)34-15-3-9-18(10-4-15)41-14-19-21(29)22(30)23(31)24(32)25(19)42(2,37)38/h3-10,13H,11-12,14H2,1-2H3,(H2,33,34,35,36) |
| InChIKey | LHXJAHVCSKFHEM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|