C9H4ClF5O3S — CID 167079776
2,3,4,5-tetrafluoro-6-(1-fluoroprop-2-enoxy)benzenesulfonyl chloride (PubChem CID 167079776) has the molecular formula C9H4ClF5O3S and a molecular weight of 322.64 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(1-fluoroprop-2-enoxy)benzenesulfonyl chloride.
| Compound Name | 2,3,4,5-tetrafluoro-6-(1-fluoroprop-2-enoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 167079776 |
| Molecular Formula | C9H4ClF5O3S |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 321.95 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(1-fluoroprop-2-enoxy)benzenesulfonyl chloride |
| SMILES | C=CC(F)Oc1c(F)c(F)c(F)c(F)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H4ClF5O3S/c1-2-3(11)18-8-6(14)4(12)5(13)7(15)9(8)19(10,16)17/h2-3H,1H2 |
| InChIKey | ZYYOEPOQNAHMGZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|