C15H27FN2 — CID 167079783
1-[(7Z,8Z)-7-ethylidene-10-fluoro-6-methylundeca-8,10-dienyl]-2-methylhydrazine (PubChem CID 167079783) has the molecular formula C15H27FN2 and a molecular weight of 254.39 g/mol. Its IUPAC name is 1-[(7Z,8Z)-7-ethylidene-10-fluoro-6-methylundeca-8,10-dienyl]-2-methylhydrazine.
| Compound Name | 1-[(7Z,8Z)-7-ethylidene-10-fluoro-6-methylundeca-8,10-dienyl]-2-methylhydrazine |
|---|---|
| PubChem CID | 167079783 |
| Molecular Formula | C15H27FN2 |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 1-[(7Z,8Z)-7-ethylidene-10-fluoro-6-methylundeca-8,10-dienyl]-2-methylhydrazine |
| SMILES | C=C(F)/C=C\C(=C/C)C(C)CCCCCNNC |
| InChI | InChI=1S/C15H27FN2/c1-5-15(11-10-14(3)16)13(2)9-7-6-8-12-18-17-4/h5,10-11,13,17-18H,3,6-9,12H2,1-2,4H3/b11-10-,15-5+ |
| InChIKey | WKKDMXHRKBOQFZ-QKUPDRDPSA-N |
| XLogP | 3.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|