C17H31NO2 — CID 167079867
(2E,3Z,7E)-N-(2-ethoxyethyl)-7-methoxy-2-propylidenenona-3,7-dien-1-amine (PubChem CID 167079867) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (2E,3Z,7E)-N-(2-ethoxyethyl)-7-methoxy-2-propylidenenona-3,7-dien-1-amine.
| Compound Name | (2E,3Z,7E)-N-(2-ethoxyethyl)-7-methoxy-2-propylidenenona-3,7-dien-1-amine |
|---|---|
| PubChem CID | 167079867 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (2E,3Z,7E)-N-(2-ethoxyethyl)-7-methoxy-2-propylidenenona-3,7-dien-1-amine |
| SMILES | C/C=C(\CC/C=C\C(=C/CC)CNCCOCC)OC |
| InChI | InChI=1S/C17H31NO2/c1-5-10-16(15-18-13-14-20-7-3)11-8-9-12-17(6-2)19-4/h6,8,10-11,18H,5,7,9,12-15H2,1-4H3/b11-8-,16-10+,17-6+ |
| InChIKey | BXWGZMHLJMUXRF-ZHRQAIGDSA-N |
| XLogP | 3.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|