C10H17F3O — CID 167080202
(E)-1,1,1-trifluoro-5-methoxy-2,6-dimethylhept-2-ene (PubChem CID 167080202) has the molecular formula C10H17F3O and a molecular weight of 210.24 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-5-methoxy-2,6-dimethylhept-2-ene.
| Compound Name | (E)-1,1,1-trifluoro-5-methoxy-2,6-dimethylhept-2-ene |
|---|---|
| PubChem CID | 167080202 |
| Molecular Formula | C10H17F3O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (E)-1,1,1-trifluoro-5-methoxy-2,6-dimethylhept-2-ene |
| SMILES | COC(C/C=C(\C)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H17F3O/c1-7(2)9(14-4)6-5-8(3)10(11,12)13/h5,7,9H,6H2,1-4H3/b8-5+ |
| InChIKey | CKKVDZPIHYONLS-VMPITWQZSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|