C13H26F3N3 — CID 167080212
1-N,2-N-dimethyl-3-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine (PubChem CID 167080212) has the molecular formula C13H26F3N3 and a molecular weight of 281.37 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine.
| Compound Name | 1-N,2-N-dimethyl-3-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 167080212 |
| Molecular Formula | C13H26F3N3 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-N,2-N-dimethyl-3-N-[(E)-2-methyl-3-(trifluoromethyl)hex-3-en-2-yl]propane-1,2,3-triamine |
| SMILES | CC/C=C(/C(F)(F)F)C(C)(C)NCC(CNC)NC |
| InChI | InChI=1S/C13H26F3N3/c1-6-7-11(13(14,15)16)12(2,3)19-9-10(18-5)8-17-4/h7,10,17-19H,6,8-9H2,1-5H3/b11-7+ |
| InChIKey | PBSYJZHUVTYUCA-YRNVUSSQSA-N |
| XLogP | 2.06 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|