C19H17Cl2F4N3O4S — CID 167080302
2-(4,5-dichloro-2-hydroxyanilino)-1-[4-(2,3,4,6-tetrafluoro-5-methylsulfonylphenyl)piperazin-1-yl]ethanone (PubChem CID 167080302) has the molecular formula C19H17Cl2F4N3O4S and a molecular weight of 530.33 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-1-[4-(2,3,4,6-tetrafluoro-5-methylsulfonylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-[4-(2,3,4,6-tetrafluoro-5-methylsulfonylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 167080302 |
| Molecular Formula | C19H17Cl2F4N3O4S |
| Molecular Weight | 530.33 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-[4-(2,3,4,6-tetrafluoro-5-methylsulfonylphenyl)piperazin-1-yl]ethanone |
| SMILES | CS(=O)(=O)c1c(F)c(F)c(F)c(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3O)CC2)c1F |
| InChI | InChI=1S/C19H17Cl2F4N3O4S/c1-33(31,32)19-16(24)14(22)15(23)18(17(19)25)28-4-2-27(3-5-28)13(30)8-26-11-6-9(20)10(21)7-12(11)29/h6-7,26,29H,2-5,8H2,1H3 |
| InChIKey | JERLVAJWNAUDBC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|