C19H17Cl2F5N4O5S — CID 167080304
3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-4-(difluoromethoxy)-2,5,6-trifluorobenzenesulfonamide (PubChem CID 167080304) has the molecular formula C19H17Cl2F5N4O5S and a molecular weight of 579.33 g/mol. Its IUPAC name is 3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-4-(difluoromethoxy)-2,5,6-trifluorobenzenesulfonamide.
| Compound Name | 3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-4-(difluoromethoxy)-2,5,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 167080304 |
| Molecular Formula | C19H17Cl2F5N4O5S |
| Molecular Weight | 579.33 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | 3-[4-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperazin-1-yl]-4-(difluoromethoxy)-2,5,6-trifluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(OC(F)F)c(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3O)CC2)c1F |
| InChI | InChI=1S/C19H17Cl2F5N4O5S/c20-8-5-10(11(31)6-9(8)21)28-7-12(32)29-1-3-30(4-2-29)16-15(24)18(36(27,33)34)14(23)13(22)17(16)35-19(25)26/h5-6,19,28,31H,1-4,7H2,(H2,27,33,34) |
| InChIKey | GLAQJCNDAJRSRW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|