C19H16Cl2F5N3O5S — CID 167080357
2-(4,5-dichloro-2-hydroxyanilino)-1-[4-[2,3,4,5-tetrafluoro-6-(fluoromethoxy)phenyl]sulfonylpiperazin-1-yl]ethanone (PubChem CID 167080357) has the molecular formula C19H16Cl2F5N3O5S and a molecular weight of 564.32 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-1-[4-[2,3,4,5-tetrafluoro-6-(fluoromethoxy)phenyl]sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-[4-[2,3,4,5-tetrafluoro-6-(fluoromethoxy)phenyl]sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 167080357 |
| Molecular Formula | C19H16Cl2F5N3O5S |
| Molecular Weight | 564.32 g/mol |
| Exact Mass | 563.01 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-1-[4-[2,3,4,5-tetrafluoro-6-(fluoromethoxy)phenyl]sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CNc1cc(Cl)c(Cl)cc1O)N1CCN(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2OCF)CC1 |
| InChI | InChI=1S/C19H16Cl2F5N3O5S/c20-9-5-11(12(30)6-10(9)21)27-7-13(31)28-1-3-29(4-2-28)35(32,33)19-17(26)15(24)14(23)16(25)18(19)34-8-22/h5-6,27,30H,1-4,7-8H2 |
| InChIKey | HXHDKNZPDUTPQT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|