C20H19Cl2F4N3O4S — CID 167080471
2-(4,5-dichloro-2-hydroxyanilino)-N-[(3S)-1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)piperidin-3-yl]acetamide (PubChem CID 167080471) has the molecular formula C20H19Cl2F4N3O4S and a molecular weight of 544.35 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-N-[(3S)-1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)piperidin-3-yl]acetamide.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-N-[(3S)-1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 167080471 |
| Molecular Formula | C20H19Cl2F4N3O4S |
| Molecular Weight | 544.35 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-N-[(3S)-1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)piperidin-3-yl]acetamide |
| SMILES | CS(=O)(=O)c1c(F)c(F)c(F)c(F)c1N1CCC[C@H](NC(=O)CNc2cc(Cl)c(Cl)cc2O)C1 |
| InChI | InChI=1S/C20H19Cl2F4N3O4S/c1-34(32,33)20-18(26)16(24)15(23)17(25)19(20)29-4-2-3-9(8-29)28-14(31)7-27-12-5-10(21)11(22)6-13(12)30/h5-6,9,27,30H,2-4,7-8H2,1H3,(H,28,31)/t9-/m0/s1 |
| InChIKey | BANOWXDTINTDCM-VIFPVBQESA-N |
| XLogP | 3.86 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|