C29H24F7N5OS — CID 167080473
7-(3-methoxynaphthalen-1-yl)-4-[4-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfanylpiperazin-1-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (PubChem CID 167080473) has the molecular formula C29H24F7N5OS and a molecular weight of 623.60 g/mol. Its IUPAC name is 7-(3-methoxynaphthalen-1-yl)-4-[4-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfanylpiperazin-1-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
| Compound Name | 7-(3-methoxynaphthalen-1-yl)-4-[4-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfanylpiperazin-1-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 167080473 |
| Molecular Formula | C29H24F7N5OS |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | 7-(3-methoxynaphthalen-1-yl)-4-[4-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfanylpiperazin-1-yl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| SMILES | COc1cc(N2CCc3c(ncnc3N3CCN(Sc4c(F)c(F)c(F)c(F)c4C(F)(F)F)CC3)C2)c2ccccc2c1 |
| InChI | InChI=1S/C29H24F7N5OS/c1-42-17-12-16-4-2-3-5-18(16)21(13-17)40-7-6-19-20(14-40)37-15-38-28(19)39-8-10-41(11-9-39)43-27-22(29(34,35)36)23(30)24(31)25(32)26(27)33/h2-5,12-13,15H,6-11,14H2,1H3 |
| InChIKey | BKIUDSGUECFUBT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|