C18H15Cl2F4N3O4S — CID 167080474
2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)azetidin-3-yl]acetamide (PubChem CID 167080474) has the molecular formula C18H15Cl2F4N3O4S and a molecular weight of 516.30 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)azetidin-3-yl]acetamide.
| Compound Name | 2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)azetidin-3-yl]acetamide |
|---|---|
| PubChem CID | 167080474 |
| Molecular Formula | C18H15Cl2F4N3O4S |
| Molecular Weight | 516.30 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | 2-(4,5-dichloro-2-hydroxyanilino)-N-[1-(2,3,4,5-tetrafluoro-6-methylsulfonylphenyl)azetidin-3-yl]acetamide |
| SMILES | CS(=O)(=O)c1c(F)c(F)c(F)c(F)c1N1CC(NC(=O)CNc2cc(Cl)c(Cl)cc2O)C1 |
| InChI | InChI=1S/C18H15Cl2F4N3O4S/c1-32(30,31)18-16(24)14(22)13(21)15(23)17(18)27-5-7(6-27)26-12(29)4-25-10-2-8(19)9(20)3-11(10)28/h2-3,7,25,28H,4-6H2,1H3,(H,26,29) |
| InChIKey | GDVMMCLYKNIDGQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|