About 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine
2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine (PubChem CID 167080864) has the molecular formula C13H20F3NO
and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 167080864 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine |
| SMILES | COC1=CC[C@H](CCN(C)C)CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C13H20F3NO/c1-17(2)7-6-10-4-5-12(18-3)9-11(8-10)13(14,15)16/h5,9-10H,4,6-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | GJLDDWAIRRPQFR-SNVBAGLBSA-N |
| XLogP | 3.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine (CID 167080864) is 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine is COC1=CC[C@H](CCN(C)C)CC(C(F)(F)F)=C1.
What is the InChIKey of 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine?
The InChIKey is GJLDDWAIRRPQFR-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H20F3NO/c1-17(2)7-6-10-4-5-12(18-3)9-11(8-10)13(14,15)16/h5,9-10H,4,6-8H2,1-3H3/t10-/m1/s1.
What are the key properties of 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine?
2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine has a molecular weight of 263.30 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-5-methoxy-3-(trifluoromethyl)cyclohepta-3,5-dien-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 167080864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).