About methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate
methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate (PubChem CID 167080897) has the molecular formula C21H18F2N2O4
and a molecular weight of 400.38 g/mol. Its IUPAC name is methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate |
| PubChem CID | 167080897 |
| Molecular Formula | C21H18F2N2O4 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate |
| SMILES | C=C1C(Nc2cc(F)c(O)c(F)c2)=CC(=O)N1CCc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H18F2N2O4/c1-12-18(24-15-9-16(22)20(27)17(23)10-15)11-19(26)25(12)7-6-13-4-3-5-14(8-13)21(28)29-2/h3-5,8-11,24,27H,1,6-7H2,2H3 |
| InChIKey | UUCDBHMRHPQBMS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate?
The IUPAC name of methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate (CID 167080897) is methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate.
What is the SMILES notation for methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate?
The canonical SMILES for methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate is C=C1C(Nc2cc(F)c(O)c(F)c2)=CC(=O)N1CCc1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate?
The InChIKey is UUCDBHMRHPQBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N2O4/c1-12-18(24-15-9-16(22)20(27)17(23)10-15)11-19(26)25(12)7-6-13-4-3-5-14(8-13)21(28)29-2/h3-5,8-11,24,27H,1,6-7H2,2H3.
What are the key properties of methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate?
methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate has a molecular weight of 400.38 g/mol, XLogP of 3.35, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-[3-(3,5-difluoro-4-hydroxyanilino)-2-methylidene-5-oxopyrrol-1-yl]ethyl]benzoate is sourced from PubChem (CID 167080897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).