C23H35N3O6S — CID 167080970
15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,10,18-trioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene (PubChem CID 167080970) has the molecular formula C23H35N3O6S and a molecular weight of 481.62 g/mol. Its IUPAC name is 15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,10,18-trioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene.
| Compound Name | 15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,10,18-trioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene |
|---|---|
| PubChem CID | 167080970 |
| Molecular Formula | C23H35N3O6S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,10,18-trioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene |
| SMILES | CC1CC(NS(=O)(=O)N(C)C)C2COC3CCC(CC3)c3cccc(c3)OCCOC(=O)N12 |
| InChI | InChI=1S/C23H35N3O6S/c1-16-13-21(24-33(28,29)25(2)3)22-15-32-19-9-7-17(8-10-19)18-5-4-6-20(14-18)30-11-12-31-23(27)26(16)22/h4-6,14,16-17,19,21-22,24H,7-13,15H2,1-3H3 |
| InChIKey | AHKAUACERUFWPY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |