C21H31N3O6S — CID 167080973
N-(13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide (PubChem CID 167080973) has the molecular formula C21H31N3O6S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-(13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide.
| Compound Name | N-(13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide |
|---|---|
| PubChem CID | 167080973 |
| Molecular Formula | C21H31N3O6S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-(13-methyl-11-oxo-7,10,18-trioxa-12,24-diazatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-trien-15-yl)methanesulfonamide |
| SMILES | CC1CC(NS(C)(=O)=O)C2COC3CCC(CC3)c3cccc(n3)OCCOC(=O)N12 |
| InChI | InChI=1S/C21H31N3O6S/c1-14-12-18(23-31(2,26)27)19-13-30-16-8-6-15(7-9-16)17-4-3-5-20(22-17)28-10-11-29-21(25)24(14)19/h3-5,14-16,18-19,23H,6-13H2,1-2H3 |
| InChIKey | WVFXYDZOGYLDMS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |