C22H33N3O6S — CID 167081036
N-(14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide (PubChem CID 167081036) has the molecular formula C22H33N3O6S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-(14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide.
| Compound Name | N-(14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide |
|---|---|
| PubChem CID | 167081036 |
| Molecular Formula | C22H33N3O6S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-(14-methyl-12-oxo-7,11,19-trioxa-13,25-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-trien-16-yl)methanesulfonamide |
| SMILES | CC1CC(NS(C)(=O)=O)C2COC3CCC(CC3)c3cccc(n3)OCCCOC(=O)N12 |
| InChI | InChI=1S/C22H33N3O6S/c1-15-13-19(24-32(2,27)28)20-14-31-17-9-7-16(8-10-17)18-5-3-6-21(23-18)29-11-4-12-30-22(26)25(15)20/h3,5-6,15-17,19-20,24H,4,7-14H2,1-2H3 |
| InChIKey | FHGPLEXQYXUKIC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |