C24H38N4O4S — CID 167081052
16-(dimethylsulfamoylamino)-12-oxo-19-oxa-7,13-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene (PubChem CID 167081052) has the molecular formula C24H38N4O4S and a molecular weight of 478.66 g/mol. Its IUPAC name is 16-(dimethylsulfamoylamino)-12-oxo-19-oxa-7,13-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene.
| Compound Name | 16-(dimethylsulfamoylamino)-12-oxo-19-oxa-7,13-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene |
|---|---|
| PubChem CID | 167081052 |
| Molecular Formula | C24H38N4O4S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 16-(dimethylsulfamoylamino)-12-oxo-19-oxa-7,13-diazatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene |
| SMILES | CN(C)S(=O)(=O)NC1CCN2C(=O)CCCCNc3cccc(c3)C3CCC(CC3)OCC12 |
| InChI | InChI=1S/C24H38N4O4S/c1-27(2)33(30,31)26-22-13-15-28-23(22)17-32-21-11-9-18(10-12-21)19-6-5-7-20(16-19)25-14-4-3-8-24(28)29/h5-7,16,18,21-23,25-26H,3-4,8-15,17H2,1-2H3 |
| InChIKey | LJZMLJBVIVNFCJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |